About 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol
5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol (PubChem CID 123574974) has the molecular formula C16H28O3Si
and a molecular weight of 296.48 g/mol. Its IUPAC name is 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol.
Molecular Properties
| Compound Name | 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol |
| PubChem CID | 123574974 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol |
| SMILES | CC[Si](CC)(CC)OC1CCC2C1=CC1CC(O)C2O1 |
| InChI | InChI=1S/C16H28O3Si/c1-4-20(5-2,6-3)19-15-8-7-12-13(15)9-11-10-14(17)16(12)18-11/h9,11-12,14-17H,4-8,10H2,1-3H3 |
| InChIKey | VOMKTQXZOXDSPH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol?
The IUPAC name of 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol (CID 123574974) is 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol.
What is the SMILES notation for 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol?
The canonical SMILES for 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol is CC[Si](CC)(CC)OC1CCC2C1=CC1CC(O)C2O1.
What is the InChIKey of 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol?
The InChIKey is VOMKTQXZOXDSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3Si/c1-4-20(5-2,6-3)19-15-8-7-12-13(15)9-11-10-14(17)16(12)18-11/h9,11-12,14-17H,4-8,10H2,1-3H3.
What are the key properties of 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol?
5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol has a molecular weight of 296.48 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol is sourced from PubChem (CID 123574974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).