C14H19N — CID 123575362
3-[(6-methylcyclohepta-1,2,4,6-tetraen-1-yl)methyl]pentan-1-imine (PubChem CID 123575362) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[(6-methylcyclohepta-1,2,4,6-tetraen-1-yl)methyl]pentan-1-imine.
| Compound Name | 3-[(6-methylcyclohepta-1,2,4,6-tetraen-1-yl)methyl]pentan-1-imine |
|---|---|
| PubChem CID | 123575362 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[(6-methylcyclohepta-1,2,4,6-tetraen-1-yl)methyl]pentan-1-imine |
| SMILES | [H]/N=C/CC(CC)CC1=C=CC=CC(C)=C1 |
| InChI | InChI=1S/C14H19N/c1-3-13(8-9-15)11-14-7-5-4-6-12(2)10-14/h4-6,9-10,13,15H,3,8,11H2,1-2H3/b15-9+ |
| InChIKey | NECLQJJJFPUQTB-OQLLNIDSSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|