C15H21FN4O — CID 123575763
3-[3-fluoro-4-[2-(methylamino)ethylimino]cyclohexen-1-yl]-2,6-dimethylpyrimidin-4-one (PubChem CID 123575763) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[3-fluoro-4-[2-(methylamino)ethylimino]cyclohexen-1-yl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[3-fluoro-4-[2-(methylamino)ethylimino]cyclohexen-1-yl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 123575763 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[3-fluoro-4-[2-(methylamino)ethylimino]cyclohexen-1-yl]-2,6-dimethylpyrimidin-4-one |
| SMILES | CNCC/N=C1\CCC(n2c(C)nc(C)cc2=O)=CC1F |
| InChI | InChI=1S/C15H21FN4O/c1-10-8-15(21)20(11(2)19-10)12-4-5-14(13(16)9-12)18-7-6-17-3/h8-9,13,17H,4-7H2,1-3H3/b18-14+ |
| InChIKey | FHBSIAOWMLGJDJ-NBVRZTHBSA-N |
| XLogP | 1.49 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|