C16H15F3N4O — CID 123576008
N-[4-(2-oxa-5-azabicyclo[2.2.1]heptan-1-yl)phenyl]-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 123576008) has the molecular formula C16H15F3N4O and a molecular weight of 336.32 g/mol. Its IUPAC name is N-[4-(2-oxa-5-azabicyclo[2.2.1]heptan-1-yl)phenyl]-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[4-(2-oxa-5-azabicyclo[2.2.1]heptan-1-yl)phenyl]-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 123576008 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[4-(2-oxa-5-azabicyclo[2.2.1]heptan-1-yl)phenyl]-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nccc(Nc2ccc(C34CNC(CO3)C4)cc2)n1 |
| InChI | InChI=1S/C16H15F3N4O/c17-16(18,19)14-20-6-5-13(23-14)22-11-3-1-10(2-4-11)15-7-12(8-24-15)21-9-15/h1-6,12,21H,7-9H2,(H,20,22,23) |
| InChIKey | BYCRBNADMVBJPC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |