C28H32F2N2O2+2 — CID 123576073
3-(6,7-diethyl-9,11-difluoro-7-methylbenzo[a]quinolizin-5-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate (PubChem CID 123576073) has the molecular formula C28H32F2N2O2+2 and a molecular weight of 466.57 g/mol. Its IUPAC name is 3-(6,7-diethyl-9,11-difluoro-7-methylbenzo[a]quinolizin-5-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate.
| Compound Name | 3-(6,7-diethyl-9,11-difluoro-7-methylbenzo[a]quinolizin-5-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 123576073 |
| Molecular Formula | C28H32F2N2O2+2 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 3-(6,7-diethyl-9,11-difluoro-7-methylbenzo[a]quinolizin-5-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate |
| SMILES | CCC1(C)c2cc(F)cc(F)c2-c2cccc[n+]2C1(CC)CCCOC(=O)c1cccc[n+]1C |
| InChI | InChI=1S/C28H32F2N2O2/c1-5-27(3)21-18-20(29)19-22(30)25(21)23-12-8-10-16-32(23)28(27,6-2)14-11-17-34-26(33)24-13-7-9-15-31(24)4/h7-10,12-13,15-16,18-19H,5-6,11,14,17H2,1-4H3/q+2 |
| InChIKey | CPKWBEUIRHEMQO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|