About 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one
6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one (PubChem CID 123576182) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one.
Molecular Properties
| Compound Name | 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one |
| PubChem CID | 123576182 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one |
| SMILES | CC1(C)C2CCC3(COC3=O)C1C2 |
| InChI | InChI=1S/C11H16O2/c1-10(2)7-3-4-11(8(10)5-7)6-13-9(11)12/h7-8H,3-6H2,1-2H3 |
| InChIKey | HJRMIGGDSYUTMR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one?
The IUPAC name of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one (CID 123576182) is 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one.
What is the SMILES notation for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one?
The canonical SMILES for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one is CC1(C)C2CCC3(COC3=O)C1C2.
What is the InChIKey of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one?
The InChIKey is HJRMIGGDSYUTMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-10(2)7-3-4-11(8(10)5-7)6-13-9(11)12/h7-8H,3-6H2,1-2H3.
What are the key properties of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one?
6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one has a molecular weight of 180.25 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxetane]-2'-one is sourced from PubChem (CID 123576182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).