C24H28N4O5S — CID 123576276
4-(1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene (PubChem CID 123576276) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-(1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene.
| Compound Name | 4-(1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 123576276 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-(1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
| SMILES | CS(=O)(=O)C1(c2nc(-c3cccc4[nH]ccc34)nc3c2OCCC2COCCN32)CCOCC1 |
| InChI | InChI=1S/C24H28N4O5S/c1-34(29,30)24(7-12-31-13-8-24)21-20-23(28-10-14-32-15-16(28)6-11-33-20)27-22(26-21)18-3-2-4-19-17(18)5-9-25-19/h2-5,9,16,25H,6-8,10-15H2,1H3 |
| InChIKey | WZPJEEVKCVUDEA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |