C19H14F3N5 — CID 123576831
1-phenyl-2-[4-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]hydrazine (PubChem CID 123576831) has the molecular formula C19H14F3N5 and a molecular weight of 369.35 g/mol. Its IUPAC name is 1-phenyl-2-[4-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]hydrazine.
| Compound Name | 1-phenyl-2-[4-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 123576831 |
| Molecular Formula | C19H14F3N5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-phenyl-2-[4-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]hydrazine |
| SMILES | FC(F)(F)c1nnc2ccc(-c3ccc(NNc4ccccc4)cc3)cn12 |
| InChI | InChI=1S/C19H14F3N5/c20-19(21,22)18-26-25-17-11-8-14(12-27(17)18)13-6-9-16(10-7-13)24-23-15-4-2-1-3-5-15/h1-12,23-24H |
| InChIKey | BEHCVQQEMRMZCI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|