About N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine
N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine (PubChem CID 123577773) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine.
Molecular Properties
| Compound Name | N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine |
| PubChem CID | 123577773 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine |
| SMILES | C=NC=CC(=C)C(C)=CC=C(C)F |
| InChI | InChI=1S/C11H14FN/c1-9(5-6-11(3)12)10(2)7-8-13-4/h5-8H,2,4H2,1,3H3 |
| InChIKey | WTTQZUOWYTWJHH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine?
The IUPAC name of N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine (CID 123577773) is N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine.
What is the SMILES notation for N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine?
The canonical SMILES for N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine is C=NC=CC(=C)C(C)=CC=C(C)F.
What is the InChIKey of N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine?
The InChIKey is WTTQZUOWYTWJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-9(5-6-11(3)12)10(2)7-8-13-4/h5-8H,2,4H2,1,3H3.
What are the key properties of N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine?
N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine has a molecular weight of 179.24 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl)methanimine is sourced from PubChem (CID 123577773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).