About 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile
9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile (PubChem CID 123577939) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile.
Molecular Properties
| Compound Name | 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile |
| PubChem CID | 123577939 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile |
| SMILES | CC(=CC=CC#N)CC#CCN(C)C |
| InChI | InChI=1S/C12H16N2/c1-12(8-4-6-10-13)9-5-7-11-14(2)3/h4,6,8H,9,11H2,1-3H3 |
| InChIKey | GTGFPJPMIKSJLJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile?
The IUPAC name of 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile (CID 123577939) is 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile.
What is the SMILES notation for 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile?
The canonical SMILES for 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile is CC(=CC=CC#N)CC#CCN(C)C.
What is the InChIKey of 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile?
The InChIKey is GTGFPJPMIKSJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-12(8-4-6-10-13)9-5-7-11-14(2)3/h4,6,8H,9,11H2,1-3H3.
What are the key properties of 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile?
9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile has a molecular weight of 188.27 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(dimethylamino)-5-methylnona-2,4-dien-7-ynenitrile is sourced from PubChem (CID 123577939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).