About 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one
5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one (PubChem CID 123578250) has the molecular formula C8H9F2NO
and a molecular weight of 173.16 g/mol. Its IUPAC name is 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one |
| PubChem CID | 123578250 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one |
| SMILES | CCc1c(F)[nH]c(=O)c(C)c1F |
| InChI | InChI=1S/C8H9F2NO/c1-3-5-6(9)4(2)8(12)11-7(5)10/h3H2,1-2H3,(H,11,12) |
| InChIKey | JSOIQBKOGLEVIJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one?
The IUPAC name of 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one (CID 123578250) is 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one.
What is the SMILES notation for 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one?
The canonical SMILES for 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one is CCc1c(F)[nH]c(=O)c(C)c1F.
What is the InChIKey of 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one?
The InChIKey is JSOIQBKOGLEVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO/c1-3-5-6(9)4(2)8(12)11-7(5)10/h3H2,1-2H3,(H,11,12).
What are the key properties of 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one?
5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one has a molecular weight of 173.16 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6-difluoro-3-methyl-1H-pyridin-2-one is sourced from PubChem (CID 123578250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).