C17H25N — CID 123578497
1-hepta-1,3,5-trien-2-yl-3,7a-dimethyl-3,3a,4,5-tetrahydro-2H-indole (PubChem CID 123578497) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-hepta-1,3,5-trien-2-yl-3,7a-dimethyl-3,3a,4,5-tetrahydro-2H-indole.
| Compound Name | 1-hepta-1,3,5-trien-2-yl-3,7a-dimethyl-3,3a,4,5-tetrahydro-2H-indole |
|---|---|
| PubChem CID | 123578497 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1-hepta-1,3,5-trien-2-yl-3,7a-dimethyl-3,3a,4,5-tetrahydro-2H-indole |
| SMILES | C=C(C=CC=CC)N1CC(C)C2CCC=CC21C |
| InChI | InChI=1S/C17H25N/c1-5-6-7-10-15(3)18-13-14(2)16-11-8-9-12-17(16,18)4/h5-7,9-10,12,14,16H,3,8,11,13H2,1-2,4H3 |
| InChIKey | YQTCCYNFBJRCFT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|