C20H43NO2 — CID 123578525
6-(2-hydroxyethylamino)-2,2,4,4,7,7,9,9-octamethyldecan-5-ol (PubChem CID 123578525) has the molecular formula C20H43NO2 and a molecular weight of 329.57 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-2,2,4,4,7,7,9,9-octamethyldecan-5-ol.
| Compound Name | 6-(2-hydroxyethylamino)-2,2,4,4,7,7,9,9-octamethyldecan-5-ol |
|---|---|
| PubChem CID | 123578525 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 6-(2-hydroxyethylamino)-2,2,4,4,7,7,9,9-octamethyldecan-5-ol |
| SMILES | CC(C)(C)CC(C)(C)C(O)C(NCCO)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H43NO2/c1-17(2,3)13-19(7,8)15(21-11-12-22)16(23)20(9,10)14-18(4,5)6/h15-16,21-23H,11-14H2,1-10H3 |
| InChIKey | NUPXNOZQOSEHTD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |