About [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate
[[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate (PubChem CID 123579234) has the molecular formula C28H26N2O3S
and a molecular weight of 470.59 g/mol. Its IUPAC name is [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate.
Molecular Properties
| Compound Name | [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate |
| PubChem CID | 123579234 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)C(NOC(C)=O)=CC(C)S3 |
| InChI | InChI=1S/C28H26N2O3S/c1-5-30-24-12-10-19(27(32)20-9-7-6-8-16(20)2)15-22(24)26-25(30)13-11-21-23(29-33-18(4)31)14-17(3)34-28(21)26/h6-15,17,29H,5H2,1-4H3 |
| InChIKey | QXLSIVOVWCHUCG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate?
The IUPAC name of [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate (CID 123579234) is [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate.
What is the SMILES notation for [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate?
The canonical SMILES for [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate is CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)C(NOC(C)=O)=CC(C)S3.
What is the InChIKey of [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate?
The InChIKey is QXLSIVOVWCHUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O3S/c1-5-30-24-12-10-19(27(32)20-9-7-6-8-16(20)2)15-22(24)26-25(30)13-11-21-23(29-33-18(4)31)14-17(3)34-28(21)26/h6-15,17,29H,5H2,1-4H3.
What are the key properties of [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate?
[[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate has a molecular weight of 470.59 g/mol, XLogP of 6.26, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[7-ethyl-2-methyl-10-(2-methylbenzoyl)-2H-thiopyrano[3,2-c]carbazol-4-yl]amino] acetate is sourced from PubChem (CID 123579234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).