C28H35N3O7 — CID 123579404
N-(8-benzyl-3-cyclopropyl-2,7-dihydroxy-6,12-dimethyl-5,10-dioxo-1-oxa-4,9-diazacyclododec-11-yl)-2-hydroxybenzamide (PubChem CID 123579404) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is N-(8-benzyl-3-cyclopropyl-2,7-dihydroxy-6,12-dimethyl-5,10-dioxo-1-oxa-4,9-diazacyclododec-11-yl)-2-hydroxybenzamide.
| Compound Name | N-(8-benzyl-3-cyclopropyl-2,7-dihydroxy-6,12-dimethyl-5,10-dioxo-1-oxa-4,9-diazacyclododec-11-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 123579404 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | N-(8-benzyl-3-cyclopropyl-2,7-dihydroxy-6,12-dimethyl-5,10-dioxo-1-oxa-4,9-diazacyclododec-11-yl)-2-hydroxybenzamide |
| SMILES | CC1OC(O)C(C2CC2)NC(=O)C(C)C(O)C(Cc2ccccc2)NC(=O)C1NC(=O)c1ccccc1O |
| InChI | InChI=1S/C28H35N3O7/c1-15-24(33)20(14-17-8-4-3-5-9-17)29-27(36)22(30-26(35)19-10-6-7-11-21(19)32)16(2)38-28(37)23(18-12-13-18)31-25(15)34/h3-11,15-16,18,20,22-24,28,32-33,37H,12-14H2,1-2H3,(H,29,36)(H,30,35)(H,31,34) |
| InChIKey | ARWMLDQGKOZTBA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |