C25H22Br2O7 — CID 123579415
6-[(4S,5R)-2-(6,8-dibromo-4-oxochromen-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 123579415) has the molecular formula C25H22Br2O7 and a molecular weight of 594.25 g/mol. Its IUPAC name is 6-[(4S,5R)-2-(6,8-dibromo-4-oxochromen-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[(4S,5R)-2-(6,8-dibromo-4-oxochromen-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 123579415 |
| Molecular Formula | C25H22Br2O7 |
| Molecular Weight | 594.25 g/mol |
| Exact Mass | 591.97 |
| IUPAC Name | 6-[(4S,5R)-2-(6,8-dibromo-4-oxochromen-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CC[C@@H]1COC(c2coc3c(Br)cc(Br)cc3c2=O)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C25H22Br2O7/c26-15-10-17-22(31)18(13-32-24(17)19(27)11-15)25-33-12-14(6-2-1-3-9-21(29)30)23(34-25)16-7-4-5-8-20(16)28/h1-2,4-5,7-8,10-11,13-14,23,25,28H,3,6,9,12H2,(H,29,30)/t14-,23+,25?/m1/s1 |
| InChIKey | CHBSNTAHUICTQM-OVLBYGLXSA-N |
| XLogP | 6.24 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.25 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|