About propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate
propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate (PubChem CID 123580230) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate.
Molecular Properties
| Compound Name | propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate |
| PubChem CID | 123580230 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate |
| SMILES | CCCOC(=O)C(C#N)C1=C/C(=N/CC2COC(C)(C)O2)CCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-4-8-22-17(21)16(10-19)13-6-5-7-14(9-13)20-11-15-12-23-18(2,3)24-15/h9,15-16H,4-8,11-12H2,1-3H3/b20-14+ |
| InChIKey | FWARVELTPSXFRM-XSFVSMFZSA-N |
| XLogP | 2.78 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate?
The IUPAC name of propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate (CID 123580230) is propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate.
What is the SMILES notation for propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate?
The canonical SMILES for propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate is CCCOC(=O)C(C#N)C1=C/C(=N/CC2COC(C)(C)O2)CCC1.
What is the InChIKey of propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate?
The InChIKey is FWARVELTPSXFRM-XSFVSMFZSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-4-8-22-17(21)16(10-19)13-6-5-7-14(9-13)20-11-15-12-23-18(2,3)24-15/h9,15-16H,4-8,11-12H2,1-3H3/b20-14+.
What are the key properties of propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate?
propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate has a molecular weight of 334.42 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-cyano-2-[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylimino]cyclohexen-1-yl]acetate is sourced from PubChem (CID 123580230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).