About 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide
4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 123580517) has the molecular formula C9H16N2O2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 123580517 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CC1(CCN)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C9H16N2O2S/c1-9(6-7-10)4-2-8(3-5-9)14(11,12)13/h2-4H,5-7,10H2,1H3,(H2,11,12,13) |
| InChIKey | DDVYVAILTJJYHR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide (CID 123580517) is 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide is CC1(CCN)C=CC(S(N)(=O)=O)=CC1.
What is the InChIKey of 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is DDVYVAILTJJYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S/c1-9(6-7-10)4-2-8(3-5-9)14(11,12)13/h2-4H,5-7,10H2,1H3,(H2,11,12,13).
What are the key properties of 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide?
4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 216.31 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-4-methylcyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 123580517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).