C26H23N3O5 — CID 123580995
[2-[3-(hydroxyamino)-4-methylphenyl]-2-oxoethyl] 3-(4-methoxyphenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 123580995) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-[3-(hydroxyamino)-4-methylphenyl]-2-oxoethyl] 3-(4-methoxyphenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-[3-(hydroxyamino)-4-methylphenyl]-2-oxoethyl] 3-(4-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 123580995 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [2-[3-(hydroxyamino)-4-methylphenyl]-2-oxoethyl] 3-(4-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)OCC(=O)c2ccc(C)c(NO)c2)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-17-8-9-19(14-23(17)28-32)24(30)16-34-26(31)22-15-29(20-6-4-3-5-7-20)27-25(22)18-10-12-21(33-2)13-11-18/h3-15,28,32H,16H2,1-2H3 |
| InChIKey | HMGRTCUCZWWAKH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|