About 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine
2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine (PubChem CID 123581155) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine |
| PubChem CID | 123581155 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine |
| SMILES | CCCC(C)C1CN=CCS1 |
| InChI | InChI=1S/C9H17NS/c1-3-4-8(2)9-7-10-5-6-11-9/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | CPHVEQARFGICKP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine?
The IUPAC name of 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine (CID 123581155) is 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine.
What is the SMILES notation for 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine?
The canonical SMILES for 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine is CCCC(C)C1CN=CCS1.
What is the InChIKey of 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine?
The InChIKey is CPHVEQARFGICKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-3-4-8(2)9-7-10-5-6-11-9/h5,8-9H,3-4,6-7H2,1-2H3.
What are the key properties of 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine?
2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine has a molecular weight of 171.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-2-yl-3,6-dihydro-2H-1,4-thiazine is sourced from PubChem (CID 123581155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).