C9H8F6O6 — CID 123581245
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxo-2-propanoyloxypropanoic acid (PubChem CID 123581245) has the molecular formula C9H8F6O6 and a molecular weight of 326.15 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxo-2-propanoyloxypropanoic acid.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxo-2-propanoyloxypropanoic acid |
|---|---|
| PubChem CID | 123581245 |
| Molecular Formula | C9H8F6O6 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxo-2-propanoyloxypropanoic acid |
| SMILES | CCC(=O)OC(C(=O)O)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O6/c1-2-3(16)20-4(5(17)18)6(19)21-7(8(10,11)12)9(13,14)15/h4,7H,2H2,1H3,(H,17,18) |
| InChIKey | WWDGMOSMQWPUFV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|