C19H27NO5S — CID 123581658
[4-(8-hydroxy-1-oxo-8-propyl-2-azaspiro[4.5]decan-2-yl)phenyl]methanesulfonic acid (PubChem CID 123581658) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is [4-(8-hydroxy-1-oxo-8-propyl-2-azaspiro[4.5]decan-2-yl)phenyl]methanesulfonic acid.
| Compound Name | [4-(8-hydroxy-1-oxo-8-propyl-2-azaspiro[4.5]decan-2-yl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 123581658 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [4-(8-hydroxy-1-oxo-8-propyl-2-azaspiro[4.5]decan-2-yl)phenyl]methanesulfonic acid |
| SMILES | CCCC1(O)CCC2(CCN(c3ccc(CS(=O)(=O)O)cc3)C2=O)CC1 |
| InChI | InChI=1S/C19H27NO5S/c1-2-7-19(22)10-8-18(9-11-19)12-13-20(17(18)21)16-5-3-15(4-6-16)14-26(23,24)25/h3-6,22H,2,7-14H2,1H3,(H,23,24,25) |
| InChIKey | RWBGYQSIXAPRGP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|