C35H41F2N3O4 — CID 123582661
N-[10-[(5-acetyl-2-pyridinyl)oxy]-5-ethyl-7-fluoro-3,3-dimethyldeca-5,7-dien-2-yl]-6-[1-(3-fluorophenyl)ethoxy]pyridine-3-carboxamide (PubChem CID 123582661) has the molecular formula C35H41F2N3O4 and a molecular weight of 605.73 g/mol. Its IUPAC name is N-[10-[(5-acetyl-2-pyridinyl)oxy]-5-ethyl-7-fluoro-3,3-dimethyldeca-5,7-dien-2-yl]-6-[1-(3-fluorophenyl)ethoxy]pyridine-3-carboxamide.
| Compound Name | N-[10-[(5-acetyl-2-pyridinyl)oxy]-5-ethyl-7-fluoro-3,3-dimethyldeca-5,7-dien-2-yl]-6-[1-(3-fluorophenyl)ethoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123582661 |
| Molecular Formula | C35H41F2N3O4 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | N-[10-[(5-acetyl-2-pyridinyl)oxy]-5-ethyl-7-fluoro-3,3-dimethyldeca-5,7-dien-2-yl]-6-[1-(3-fluorophenyl)ethoxy]pyridine-3-carboxamide |
| SMILES | CCC(=CC(F)=CCCOc1ccc(C(C)=O)cn1)CC(C)(C)C(C)NC(=O)c1ccc(OC(C)c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C35H41F2N3O4/c1-7-26(18-30(36)12-9-17-43-32-15-13-28(21-38-32)23(2)41)20-35(5,6)25(4)40-34(42)29-14-16-33(39-22-29)44-24(3)27-10-8-11-31(37)19-27/h8,10-16,18-19,21-22,24-25H,7,9,17,20H2,1-6H3,(H,40,42) |
| InChIKey | XOIXQUHMCHIEJV-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|