About 1,2,2-trimethylsiletane
1,2,2-trimethylsiletane (PubChem CID 123582844) has the molecular formula C6H14Si
and a molecular weight of 114.26 g/mol. Its IUPAC name is 1,2,2-trimethylsiletane.
Molecular Properties
| Compound Name | 1,2,2-trimethylsiletane |
| PubChem CID | 123582844 |
| Molecular Formula | C6H14Si |
| Molecular Weight | 114.26 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 1,2,2-trimethylsiletane |
| SMILES | C[SiH]1CCC1(C)C |
| InChI | InChI=1S/C6H14Si/c1-6(2)4-5-7(6)3/h7H,4-5H2,1-3H3 |
| InChIKey | MMOYPGQJGFAJSM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trimethylsiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trimethylsiletane?
The IUPAC name of 1,2,2-trimethylsiletane (CID 123582844) is 1,2,2-trimethylsiletane.
What is the SMILES notation for 1,2,2-trimethylsiletane?
The canonical SMILES for 1,2,2-trimethylsiletane is C[SiH]1CCC1(C)C.
What is the InChIKey of 1,2,2-trimethylsiletane?
The InChIKey is MMOYPGQJGFAJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14Si/c1-6(2)4-5-7(6)3/h7H,4-5H2,1-3H3.
What are the key properties of 1,2,2-trimethylsiletane?
1,2,2-trimethylsiletane has a molecular weight of 114.26 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trimethylsiletane is sourced from PubChem (CID 123582844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).