C15H30N4O2S — CID 123583480
N-[2-methyl-3-(2H-triazol-4-ylmethyl)pentan-2-yl]-N-pentan-2-ylmethanesulfonamide (PubChem CID 123583480) has the molecular formula C15H30N4O2S and a molecular weight of 330.50 g/mol. Its IUPAC name is N-[2-methyl-3-(2H-triazol-4-ylmethyl)pentan-2-yl]-N-pentan-2-ylmethanesulfonamide.
| Compound Name | N-[2-methyl-3-(2H-triazol-4-ylmethyl)pentan-2-yl]-N-pentan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 123583480 |
| Molecular Formula | C15H30N4O2S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[2-methyl-3-(2H-triazol-4-ylmethyl)pentan-2-yl]-N-pentan-2-ylmethanesulfonamide |
| SMILES | CCCC(C)N(C(C)(C)C(CC)Cc1cn[nH]n1)S(C)(=O)=O |
| InChI | InChI=1S/C15H30N4O2S/c1-7-9-12(3)19(22(6,20)21)15(4,5)13(8-2)10-14-11-16-18-17-14/h11-13H,7-10H2,1-6H3,(H,16,17,18) |
| InChIKey | IJUMUAHFNBQNRA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |