C19H29N3O4 — CID 123584046
3-[3-[(1-aminocyclohexyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione (PubChem CID 123584046) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[3-[(1-aminocyclohexyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[(1-aminocyclohexyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 123584046 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-[3-[(1-aminocyclohexyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CCCc1c(CC2(N)CCCCC2)c(O)n(C2CCC(=O)NC2=O)c1O |
| InChI | InChI=1S/C19H29N3O4/c1-2-6-12-13(11-19(20)9-4-3-5-10-19)18(26)22(17(12)25)14-7-8-15(23)21-16(14)24/h14,25-26H,2-11,20H2,1H3,(H,21,23,24) |
| InChIKey | WYVOMGWEWZDUES-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|