C12H24F3NO2S — CID 123584588
2,2,4,4-tetramethyl-N-(trifluoromethyl)heptane-1-sulfonamide (PubChem CID 123584588) has the molecular formula C12H24F3NO2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-(trifluoromethyl)heptane-1-sulfonamide.
| Compound Name | 2,2,4,4-tetramethyl-N-(trifluoromethyl)heptane-1-sulfonamide |
|---|---|
| PubChem CID | 123584588 |
| Molecular Formula | C12H24F3NO2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-(trifluoromethyl)heptane-1-sulfonamide |
| SMILES | CCCC(C)(C)CC(C)(C)CS(=O)(=O)NC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO2S/c1-6-7-10(2,3)8-11(4,5)9-19(17,18)16-12(13,14)15/h16H,6-9H2,1-5H3 |
| InChIKey | WDEVDPYCMYDODG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|