About 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide
4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide (PubChem CID 123584868) has the molecular formula C17H32N2O2
and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide.
Molecular Properties
| Compound Name | 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide |
| PubChem CID | 123584868 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide |
| SMILES | CCCC(=O)NC(CC)C(C)(C)CC(=O)NCC1CCC1 |
| InChI | InChI=1S/C17H32N2O2/c1-5-8-15(20)19-14(6-2)17(3,4)11-16(21)18-12-13-9-7-10-13/h13-14H,5-12H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | JBZVAAFDCLYGGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide?
The IUPAC name of 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide (CID 123584868) is 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide.
What is the SMILES notation for 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide?
The canonical SMILES for 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide is CCCC(=O)NC(CC)C(C)(C)CC(=O)NCC1CCC1.
What is the InChIKey of 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide?
The InChIKey is JBZVAAFDCLYGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O2/c1-5-8-15(20)19-14(6-2)17(3,4)11-16(21)18-12-13-9-7-10-13/h13-14H,5-12H2,1-4H3,(H,18,21)(H,19,20).
What are the key properties of 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide?
4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide has a molecular weight of 296.46 g/mol, XLogP of 3.01, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butanoylamino)-N-(cyclobutylmethyl)-3,3-dimethylhexanamide is sourced from PubChem (CID 123584868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).