C21H24F2N4O3 — CID 123584977
1-[4-[2-[5-(cyclopropylmethoxy)-2-pyridinyl]-2-fluoroethanimidoyl]-3-fluorophenoxy]propan-2-ylurea (PubChem CID 123584977) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is 1-[4-[2-[5-(cyclopropylmethoxy)-2-pyridinyl]-2-fluoroethanimidoyl]-3-fluorophenoxy]propan-2-ylurea.
| Compound Name | 1-[4-[2-[5-(cyclopropylmethoxy)-2-pyridinyl]-2-fluoroethanimidoyl]-3-fluorophenoxy]propan-2-ylurea |
|---|---|
| PubChem CID | 123584977 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[4-[2-[5-(cyclopropylmethoxy)-2-pyridinyl]-2-fluoroethanimidoyl]-3-fluorophenoxy]propan-2-ylurea |
| SMILES | [H]/N=C(\c1ccc(OCC(C)NC(N)=O)cc1F)C(F)c1ccc(OCC2CC2)cn1 |
| InChI | InChI=1S/C21H24F2N4O3/c1-12(27-21(25)28)10-29-14-4-6-16(17(22)8-14)20(24)19(23)18-7-5-15(9-26-18)30-11-13-2-3-13/h4-9,12-13,19,24H,2-3,10-11H2,1H3,(H3,25,27,28)/b24-20+ |
| InChIKey | IZYGIIQIXLUYSR-HIXSDJFHSA-N |
| XLogP | 3.52 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|