C34H61N2+ — CID 123585086
3-butyl-6-[3-(4-cyclononyl-1,3-dimethyl-5-propylpyrrolidin-2-ylidene)prop-1-enyl]-1,4,5,5-tetramethyl-3,4-dihydro-2H-pyridin-1-ium (PubChem CID 123585086) has the molecular formula C34H61N2+ and a molecular weight of 497.88 g/mol. Its IUPAC name is 3-butyl-6-[3-(4-cyclononyl-1,3-dimethyl-5-propylpyrrolidin-2-ylidene)prop-1-enyl]-1,4,5,5-tetramethyl-3,4-dihydro-2H-pyridin-1-ium.
| Compound Name | 3-butyl-6-[3-(4-cyclononyl-1,3-dimethyl-5-propylpyrrolidin-2-ylidene)prop-1-enyl]-1,4,5,5-tetramethyl-3,4-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 123585086 |
| Molecular Formula | C34H61N2+ |
| Molecular Weight | 497.88 g/mol |
| Exact Mass | 497.48 |
| IUPAC Name | 3-butyl-6-[3-(4-cyclononyl-1,3-dimethyl-5-propylpyrrolidin-2-ylidene)prop-1-enyl]-1,4,5,5-tetramethyl-3,4-dihydro-2H-pyridin-1-ium |
| SMILES | CCCCC1C[N+](C)=C(C=CC=C2C(C)C(C3CCCCCCCC3)C(CCC)N2C)C(C)(C)C1C |
| InChI | InChI=1S/C34H61N2/c1-9-11-20-29-25-35(7)32(34(5,6)27(29)4)24-18-23-30-26(3)33(31(19-10-2)36(30)8)28-21-16-14-12-13-15-17-22-28/h18,23-24,26-29,31,33H,9-17,19-22,25H2,1-8H3/q+1 |
| InChIKey | BMLGMDLSOKTOBC-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.88 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|