About N-phenyl-1,3-benzothiazol-4-amine
N-phenyl-1,3-benzothiazol-4-amine (PubChem CID 123586125) has the molecular formula C13H10N2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is N-phenyl-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | N-phenyl-1,3-benzothiazol-4-amine |
| PubChem CID | 123586125 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-phenyl-1,3-benzothiazol-4-amine |
| SMILES | c1ccc(Nc2cccc3scnc23)cc1 |
| InChI | InChI=1S/C13H10N2S/c1-2-5-10(6-3-1)15-11-7-4-8-12-13(11)14-9-16-12/h1-9,15H |
| InChIKey | CITNDHMEOFWLMP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1,3-benzothiazol-4-amine?
The IUPAC name of N-phenyl-1,3-benzothiazol-4-amine (CID 123586125) is N-phenyl-1,3-benzothiazol-4-amine.
What is the SMILES notation for N-phenyl-1,3-benzothiazol-4-amine?
The canonical SMILES for N-phenyl-1,3-benzothiazol-4-amine is c1ccc(Nc2cccc3scnc23)cc1.
What is the InChIKey of N-phenyl-1,3-benzothiazol-4-amine?
The InChIKey is CITNDHMEOFWLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2S/c1-2-5-10(6-3-1)15-11-7-4-8-12-13(11)14-9-16-12/h1-9,15H.
What are the key properties of N-phenyl-1,3-benzothiazol-4-amine?
N-phenyl-1,3-benzothiazol-4-amine has a molecular weight of 226.30 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1,3-benzothiazol-4-amine is sourced from PubChem (CID 123586125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).