C8H11FO4 — CID 123586197
methyl (2R)-2-fluoro-2-[(1S,2R,3S,5R)-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]acetate (PubChem CID 123586197) has the molecular formula C8H11FO4 and a molecular weight of 190.17 g/mol. Its IUPAC name is methyl (2R)-2-fluoro-2-[(1S,2R,3S,5R)-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]acetate.
| Compound Name | methyl (2R)-2-fluoro-2-[(1S,2R,3S,5R)-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]acetate |
|---|---|
| PubChem CID | 123586197 |
| Molecular Formula | C8H11FO4 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | methyl (2R)-2-fluoro-2-[(1S,2R,3S,5R)-3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl]acetate |
| SMILES | COC(=O)[C@H](F)[C@H]1[C@@H]2O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C8H11FO4/c1-12-8(11)6(9)5-3(10)2-4-7(5)13-4/h3-7,10H,2H2,1H3/t3-,4+,5-,6+,7+/m0/s1 |
| InChIKey | VUEQQNORYPTYGO-PJEQPVAWSA-N |
| XLogP | -0.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|