(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid

C9H15NO5 — CID 123587407

IUPAC(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid
SMILESCOC[C@@H]1CC[C@@H](C(=O)O)CN1C(=O)O
InChIInChI=1S/C9H15NO5/c1-15-5-7-3-2-6(8(11)12)4-10(7)9(13)14/h6-7H,2-5H2,1H3,(H,11,12)(H,13,14)/t6-,7+/m1/s1
InChIKeyRMBLNCWVAJHCOK-RQJHMYQMSA-N
MW217.22 g/mol
LogP0.48
Rot. Bonds3

About (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid

(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid (PubChem CID 123587407) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid.

Molecular Properties

Compound Name(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid
PubChem CID123587407
Molecular FormulaC9H15NO5
Molecular Weight217.22 g/mol
Exact Mass217.10
IUPAC Name(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid
SMILESCOC[C@@H]1CC[C@@H](C(=O)O)CN1C(=O)O
InChIInChI=1S/C9H15NO5/c1-15-5-7-3-2-6(8(11)12)4-10(7)9(13)14/h6-7H,2-5H2,1H3,(H,11,12)(H,13,14)/t6-,7+/m1/s1
InChIKeyRMBLNCWVAJHCOK-RQJHMYQMSA-N
XLogP0.48
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.22
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid?
The IUPAC name of (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid (CID 123587407) is (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid.
What is the SMILES notation for (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid?
The canonical SMILES for (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid is COC[C@@H]1CC[C@@H](C(=O)O)CN1C(=O)O.
What is the InChIKey of (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid?
The InChIKey is RMBLNCWVAJHCOK-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H15NO5/c1-15-5-7-3-2-6(8(11)12)4-10(7)9(13)14/h6-7H,2-5H2,1H3,(H,11,12)(H,13,14)/t6-,7+/m1/s1.
What are the key properties of (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid?
(3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid has a molecular weight of 217.22 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-6-(methoxymethyl)piperidine-1,3-dicarboxylic acid is sourced from PubChem (CID 123587407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).