C15H12Br2 — CID 123587907
1,4-dibromo-2-ethenyl-3-prop-1-enylnaphthalene (PubChem CID 123587907) has the molecular formula C15H12Br2 and a molecular weight of 352.07 g/mol. Its IUPAC name is 1,4-dibromo-2-ethenyl-3-prop-1-enylnaphthalene.
| Compound Name | 1,4-dibromo-2-ethenyl-3-prop-1-enylnaphthalene |
|---|---|
| PubChem CID | 123587907 |
| Molecular Formula | C15H12Br2 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 1,4-dibromo-2-ethenyl-3-prop-1-enylnaphthalene |
| SMILES | C=Cc1c(C=CC)c(Br)c2ccccc2c1Br |
| InChI | InChI=1S/C15H12Br2/c1-3-7-11-10(4-2)14(16)12-8-5-6-9-13(12)15(11)17/h3-9H,2H2,1H3 |
| InChIKey | YVESGVQZCIXYKA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |