About N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide
N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 123588022) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide.
Molecular Properties
| Compound Name | N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| PubChem CID | 123588022 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | CC(C)(NC(=O)C1C2CNCC21)c1cnc2cccnn12 |
| InChI | InChI=1S/C15H19N5O/c1-15(2,11-8-17-12-4-3-5-18-20(11)12)19-14(21)13-9-6-16-7-10(9)13/h3-5,8-10,13,16H,6-7H2,1-2H3,(H,19,21) |
| InChIKey | ZKTLIVLGKFXXBA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide?
The IUPAC name of N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide (CID 123588022) is N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide.
What is the SMILES notation for N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide?
The canonical SMILES for N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide is CC(C)(NC(=O)C1C2CNCC21)c1cnc2cccnn12.
What is the InChIKey of N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide?
The InChIKey is ZKTLIVLGKFXXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O/c1-15(2,11-8-17-12-4-3-5-18-20(11)12)19-14(21)13-9-6-16-7-10(9)13/h3-5,8-10,13,16H,6-7H2,1-2H3,(H,19,21).
What are the key properties of N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide?
N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide has a molecular weight of 285.35 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazo[1,2-b]pyridazin-3-ylpropan-2-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide is sourced from PubChem (CID 123588022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).