C32H44N6O4 — CID 123588656
4-[(4-aminobenzoyl)amino]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide (PubChem CID 123588656) has the molecular formula C32H44N6O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is 4-[(4-aminobenzoyl)amino]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | 4-[(4-aminobenzoyl)amino]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123588656 |
| Molecular Formula | C32H44N6O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | 4-[(4-aminobenzoyl)amino]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CC(NC(=O)c2ccc(N)cc2)CC1C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C32H44N6O4/c1-19(34-5)28(39)37-27(32(2,3)4)31(42)38-18-23(35-29(40)21-13-15-22(33)16-14-21)17-26(38)30(41)36-25-12-8-10-20-9-6-7-11-24(20)25/h6-7,9,11,13-16,19,23,25-27,34H,8,10,12,17-18,33H2,1-5H3,(H,35,40)(H,36,41)(H,37,39) |
| InChIKey | REMFQRXWLHPPGM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|