C11H16N2O — CID 123588812
[2-(2-aminoethyl)-2-pyridin-2-ylcyclopropyl]methanol (PubChem CID 123588812) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is [2-(2-aminoethyl)-2-pyridin-2-ylcyclopropyl]methanol.
| Compound Name | [2-(2-aminoethyl)-2-pyridin-2-ylcyclopropyl]methanol |
|---|---|
| PubChem CID | 123588812 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | [2-(2-aminoethyl)-2-pyridin-2-ylcyclopropyl]methanol |
| SMILES | NCCC1(c2ccccn2)CC1CO |
| InChI | InChI=1S/C11H16N2O/c12-5-4-11(7-9(11)8-14)10-3-1-2-6-13-10/h1-3,6,9,14H,4-5,7-8,12H2 |
| InChIKey | BSZVUZKPACTEAR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |