About N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide
N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 123589572) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide.
Molecular Properties
| Compound Name | N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide |
| PubChem CID | 123589572 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | O=C(C1=CCCO1)N(CCO)CCO |
| InChI | InChI=1S/C9H15NO4/c11-5-3-10(4-6-12)9(13)8-2-1-7-14-8/h2,11-12H,1,3-7H2 |
| InChIKey | VJGUWEHQFQYJBP-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide?
The IUPAC name of N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide (CID 123589572) is N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide.
What is the SMILES notation for N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide?
The canonical SMILES for N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide is O=C(C1=CCCO1)N(CCO)CCO.
What is the InChIKey of N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide?
The InChIKey is VJGUWEHQFQYJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c11-5-3-10(4-6-12)9(13)8-2-1-7-14-8/h2,11-12H,1,3-7H2.
What are the key properties of N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide?
N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide has a molecular weight of 201.22 g/mol, XLogP of -0.90, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-hydroxyethyl)-2,3-dihydrofuran-5-carboxamide is sourced from PubChem (CID 123589572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).