C5H14BNO3 — CID 123589940
N-[2-(2-hydroxyethoxy)ethyl]-methylboronamidic acid (PubChem CID 123589940) has the molecular formula C5H14BNO3 and a molecular weight of 146.98 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-methylboronamidic acid.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 123589940 |
| Molecular Formula | C5H14BNO3 |
| Molecular Weight | 146.98 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-methylboronamidic acid |
| SMILES | CB(O)NCCOCCO |
| InChI | InChI=1S/C5H14BNO3/c1-6(9)7-2-4-10-5-3-8/h7-9H,2-5H2,1H3 |
| InChIKey | OXGPALIMJISLIO-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.98 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|