C12H17FN2O — CID 123590224
2,4-diethyl-5-(3-fluorophenyl)-1,2,4-oxadiazolidine (PubChem CID 123590224) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2,4-diethyl-5-(3-fluorophenyl)-1,2,4-oxadiazolidine.
| Compound Name | 2,4-diethyl-5-(3-fluorophenyl)-1,2,4-oxadiazolidine |
|---|---|
| PubChem CID | 123590224 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2,4-diethyl-5-(3-fluorophenyl)-1,2,4-oxadiazolidine |
| SMILES | CCN1CN(CC)C(c2cccc(F)c2)O1 |
| InChI | InChI=1S/C12H17FN2O/c1-3-14-9-15(4-2)16-12(14)10-6-5-7-11(13)8-10/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | NZWBVKXDMMVBFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |