C26H34F6O5S2 — CID 123590412
2-(1-adamantyl)propan-2-yl 3-(4-fluorosulfonyloxyphenyl)sulfanylpropanoate;1,2,2,3,3-pentafluorobutane (PubChem CID 123590412) has the molecular formula C26H34F6O5S2 and a molecular weight of 604.68 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 3-(4-fluorosulfonyloxyphenyl)sulfanylpropanoate;1,2,2,3,3-pentafluorobutane.
| Compound Name | 2-(1-adamantyl)propan-2-yl 3-(4-fluorosulfonyloxyphenyl)sulfanylpropanoate;1,2,2,3,3-pentafluorobutane |
|---|---|
| PubChem CID | 123590412 |
| Molecular Formula | C26H34F6O5S2 |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 3-(4-fluorosulfonyloxyphenyl)sulfanylpropanoate;1,2,2,3,3-pentafluorobutane |
| SMILES | CC(C)(OC(=O)CCSc1ccc(OS(=O)(=O)F)cc1)C12CC3CC(CC(C3)C1)C2.CC(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C22H29FO5S2.C4H5F5/c1-21(2,22-12-15-9-16(13-22)11-17(10-15)14-22)27-20(24)7-8-29-19-5-3-18(4-6-19)28-30(23,25)26;1-3(6,7)4(8,9)2-5/h3-6,15-17H,7-14H2,1-2H3;2H2,1H3 |
| InChIKey | DZCNMPGRAMZZMS-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|