C13H23ClN6O — CID 123590747
6-chloro-3-[4-(2-ethoxyethyl)-3,5-dimethylpiperazin-1-yl]-1,2,4-triazin-5-amine (PubChem CID 123590747) has the molecular formula C13H23ClN6O and a molecular weight of 314.82 g/mol. Its IUPAC name is 6-chloro-3-[4-(2-ethoxyethyl)-3,5-dimethylpiperazin-1-yl]-1,2,4-triazin-5-amine.
| Compound Name | 6-chloro-3-[4-(2-ethoxyethyl)-3,5-dimethylpiperazin-1-yl]-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 123590747 |
| Molecular Formula | C13H23ClN6O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-chloro-3-[4-(2-ethoxyethyl)-3,5-dimethylpiperazin-1-yl]-1,2,4-triazin-5-amine |
| SMILES | CCOCCN1C(C)CN(c2nnc(Cl)c(N)n2)CC1C |
| InChI | InChI=1S/C13H23ClN6O/c1-4-21-6-5-20-9(2)7-19(8-10(20)3)13-16-12(15)11(14)17-18-13/h9-10H,4-8H2,1-3H3,(H2,15,16,18) |
| InChIKey | QRPXEPFZAHFMNP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|