C27H42FN — CID 123590783
N-[(6-cyclobutyl-5-fluorocyclohexa-1,3-dien-1-yl)methyl]-4-methyl-3-[(4-methylcyclohex-2-en-1-yl)methyl]hept-5-en-1-amine (PubChem CID 123590783) has the molecular formula C27H42FN and a molecular weight of 399.64 g/mol. Its IUPAC name is N-[(6-cyclobutyl-5-fluorocyclohexa-1,3-dien-1-yl)methyl]-4-methyl-3-[(4-methylcyclohex-2-en-1-yl)methyl]hept-5-en-1-amine.
| Compound Name | N-[(6-cyclobutyl-5-fluorocyclohexa-1,3-dien-1-yl)methyl]-4-methyl-3-[(4-methylcyclohex-2-en-1-yl)methyl]hept-5-en-1-amine |
|---|---|
| PubChem CID | 123590783 |
| Molecular Formula | C27H42FN |
| Molecular Weight | 399.64 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | N-[(6-cyclobutyl-5-fluorocyclohexa-1,3-dien-1-yl)methyl]-4-methyl-3-[(4-methylcyclohex-2-en-1-yl)methyl]hept-5-en-1-amine |
| SMILES | CC=CC(C)C(CCNCC1=CC=CC(F)C1C1CCC1)CC1C=CC(C)CC1 |
| InChI | InChI=1S/C27H42FN/c1-4-7-21(3)24(18-22-14-12-20(2)13-15-22)16-17-29-19-25-10-6-11-26(28)27(25)23-8-5-9-23/h4,6-7,10-12,14,20-24,26-27,29H,5,8-9,13,15-19H2,1-3H3 |
| InChIKey | DRZYQHXJLYHMIB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|