About 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine
4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine (PubChem CID 123591015) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine |
| PubChem CID | 123591015 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine |
| SMILES | CC1NCN(C)C1C1CCNCC1N |
| InChI | InChI=1S/C10H22N4/c1-7-10(14(2)6-13-7)8-3-4-12-5-9(8)11/h7-10,12-13H,3-6,11H2,1-2H3 |
| InChIKey | FNDIIPLDDIQBEL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine?
The IUPAC name of 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine (CID 123591015) is 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine.
What is the SMILES notation for 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine?
The canonical SMILES for 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine is CC1NCN(C)C1C1CCNCC1N.
What is the InChIKey of 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine?
The InChIKey is FNDIIPLDDIQBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4/c1-7-10(14(2)6-13-7)8-3-4-12-5-9(8)11/h7-10,12-13H,3-6,11H2,1-2H3.
What are the key properties of 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine?
4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine has a molecular weight of 198.31 g/mol, XLogP of -0.83, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylimidazolidin-4-yl)piperidin-3-amine is sourced from PubChem (CID 123591015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).