C23H37N3 — CID 123592140
2-[3-[2-ethylbutyl(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 123592140) has the molecular formula C23H37N3 and a molecular weight of 355.57 g/mol. Its IUPAC name is 2-[3-[2-ethylbutyl(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[2-ethylbutyl(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 123592140 |
| Molecular Formula | C23H37N3 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.30 |
| IUPAC Name | 2-[3-[2-ethylbutyl(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CC)C1=CC(=C(C#N)C#N)CCC1 |
| InChI | InChI=1S/C23H37N3/c1-5-9-11-20(8-4)18-26(17-19(6-2)7-3)23-13-10-12-21(14-23)22(15-24)16-25/h14,19-20H,5-13,17-18H2,1-4H3 |
| InChIKey | OLMGJZNVFIHXFO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|