About (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine
(Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine (PubChem CID 123592458) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine.
Molecular Properties
| Compound Name | (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine |
| PubChem CID | 123592458 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine |
| SMILES | [H]/N=C(\C)C/C(OC)=C(\N=C)n1cnc(C)c1 |
| InChI | InChI=1S/C11H16N4O/c1-8(12)5-10(16-4)11(13-3)15-6-9(2)14-7-15/h6-7,12H,3,5H2,1-2,4H3/b11-10-,12-8+ |
| InChIKey | QJPRFXPBQDMTKS-WROCRQLKSA-N |
| XLogP | 2.09 |
| TPSA | 63.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine?
The IUPAC name of (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine (CID 123592458) is (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine.
What is the SMILES notation for (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine?
The canonical SMILES for (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine is [H]/N=C(\C)C/C(OC)=C(\N=C)n1cnc(C)c1.
What is the InChIKey of (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine?
The InChIKey is QJPRFXPBQDMTKS-WROCRQLKSA-N. The full InChI is InChI=1S/C11H16N4O/c1-8(12)5-10(16-4)11(13-3)15-6-9(2)14-7-15/h6-7,12H,3,5H2,1-2,4H3/b11-10-,12-8+.
What are the key properties of (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine?
(Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine has a molecular weight of 220.28 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methoxy-5-N-methylidene-5-(4-methylimidazol-1-yl)pent-4-ene-2,5-diimine is sourced from PubChem (CID 123592458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).