C18H27N3O3 — CID 123593190
4-ethyl-3-hydroxy-2,5,8-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9-dione (PubChem CID 123593190) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-ethyl-3-hydroxy-2,5,8-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9-dione.
| Compound Name | 4-ethyl-3-hydroxy-2,5,8-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9-dione |
|---|---|
| PubChem CID | 123593190 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 4-ethyl-3-hydroxy-2,5,8-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9-dione |
| SMILES | CCC1NC(=O)CNC(=O)CCCCCc2ccccc2NC1O |
| InChI | InChI=1S/C18H27N3O3/c1-2-14-18(24)21-15-10-7-6-9-13(15)8-4-3-5-11-16(22)19-12-17(23)20-14/h6-7,9-10,14,18,21,24H,2-5,8,11-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | KSRFYVPGEHZDMB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |