C25H31F2NO2 — CID 123593368
11-(4-fluoro-3-methoxyphenyl)-1-(3-fluorophenyl)-11-methyliminoundecan-4-one (PubChem CID 123593368) has the molecular formula C25H31F2NO2 and a molecular weight of 415.52 g/mol. Its IUPAC name is 11-(4-fluoro-3-methoxyphenyl)-1-(3-fluorophenyl)-11-methyliminoundecan-4-one.
| Compound Name | 11-(4-fluoro-3-methoxyphenyl)-1-(3-fluorophenyl)-11-methyliminoundecan-4-one |
|---|---|
| PubChem CID | 123593368 |
| Molecular Formula | C25H31F2NO2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 11-(4-fluoro-3-methoxyphenyl)-1-(3-fluorophenyl)-11-methyliminoundecan-4-one |
| SMILES | C/N=C(\CCCCCCC(=O)CCCc1cccc(F)c1)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C25H31F2NO2/c1-28-24(20-15-16-23(27)25(18-20)30-2)14-6-4-3-5-12-22(29)13-8-10-19-9-7-11-21(26)17-19/h7,9,11,15-18H,3-6,8,10,12-14H2,1-2H3/b28-24+ |
| InChIKey | ZSOGCLOTCBKPMC-ZZIIXHQDSA-N |
| XLogP | 6.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|