About N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine
N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine (PubChem CID 123593669) has the molecular formula C14H31NS
and a molecular weight of 245.48 g/mol. Its IUPAC name is N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine |
| PubChem CID | 123593669 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine |
| SMILES | CC(C)NC(C)C1CCC(S(C)(C)C)CC1 |
| InChI | InChI=1S/C14H31NS/c1-11(2)15-12(3)13-7-9-14(10-8-13)16(4,5)6/h11-15H,7-10H2,1-6H3 |
| InChIKey | UYXPMPUDRFTVKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine?
The IUPAC name of N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine (CID 123593669) is N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine.
What is the SMILES notation for N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine?
The canonical SMILES for N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine is CC(C)NC(C)C1CCC(S(C)(C)C)CC1.
What is the InChIKey of N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine?
The InChIKey is UYXPMPUDRFTVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NS/c1-11(2)15-12(3)13-7-9-14(10-8-13)16(4,5)6/h11-15H,7-10H2,1-6H3.
What are the key properties of N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine?
N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine has a molecular weight of 245.48 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(trimethyl-λ4-sulfanyl)cyclohexyl]ethyl]propan-2-amine is sourced from PubChem (CID 123593669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).