About [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate
[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate (PubChem CID 123593799) has the molecular formula C19H15ClF3N3O2
and a molecular weight of 409.80 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate.
Molecular Properties
| Compound Name | [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate |
| PubChem CID | 123593799 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate |
| SMILES | Cc1c(C(F)(F)F)nn(-c2cccc(Cl)c2)c1COC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c1-12-16(11-28-18(27)24-14-7-3-2-4-8-14)26(25-17(12)19(21,22)23)15-9-5-6-13(20)10-15/h2-10H,11H2,1H3,(H,24,27) |
| InChIKey | BIDNTBMIHCOVMB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate?
The IUPAC name of [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate (CID 123593799) is [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate.
What is the SMILES notation for [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate?
The canonical SMILES for [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate is Cc1c(C(F)(F)F)nn(-c2cccc(Cl)c2)c1COC(=O)Nc1ccccc1.
What is the InChIKey of [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate?
The InChIKey is BIDNTBMIHCOVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClF3N3O2/c1-12-16(11-28-18(27)24-14-7-3-2-4-8-14)26(25-17(12)19(21,22)23)15-9-5-6-13(20)10-15/h2-10H,11H2,1H3,(H,24,27).
What are the key properties of [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate?
[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate has a molecular weight of 409.80 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]methyl N-phenylcarbamate is sourced from PubChem (CID 123593799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).